potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate

C5H5KN2O3 — CID 155978283

IUPACpotassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate
SMILESCCc1nnc(C(=O)[O-])o1.[K+]
InChIInChI=1S/C5H6N2O3.K/c1-2-3-6-7-4(10-3)5(8)9;/h2H2,1H3,(H,8,9);/q;+1/p-1
InChIKeyFBVMBTADXSULSQ-UHFFFAOYSA-M
MW180.20 g/mol
LogP-4.00
Rot. Bonds2

About potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate

potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate (PubChem CID 155978283) has the molecular formula C5H5KN2O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate.

Molecular Properties

Compound Namepotassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate
PubChem CID155978283
Molecular FormulaC5H5KN2O3
Molecular Weight180.20 g/mol
Exact Mass179.99
IUPAC Namepotassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate
SMILESCCc1nnc(C(=O)[O-])o1.[K+]
InChIInChI=1S/C5H6N2O3.K/c1-2-3-6-7-4(10-3)5(8)9;/h2H2,1H3,(H,8,9);/q;+1/p-1
InChIKeyFBVMBTADXSULSQ-UHFFFAOYSA-M
XLogP-4.00
TPSA79.05 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.20
LogP ≤ 5-4.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate (CID 155978283) is potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate is CCc1nnc(C(=O)[O-])o1.[K+].
What is the InChIKey of potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is FBVMBTADXSULSQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H6N2O3.K/c1-2-3-6-7-4(10-3)5(8)9;/h2H2,1H3,(H,8,9);/q;+1/p-1.
What are the key properties of potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate?
potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 180.20 g/mol, XLogP of -4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 155978283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).