About potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate
potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate (PubChem CID 155978283) has the molecular formula C5H5KN2O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate.
Molecular Properties
| Compound Name | potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate |
| PubChem CID | 155978283 |
| Molecular Formula | C5H5KN2O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 179.99 |
| IUPAC Name | potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCc1nnc(C(=O)[O-])o1.[K+] |
| InChI | InChI=1S/C5H6N2O3.K/c1-2-3-6-7-4(10-3)5(8)9;/h2H2,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | FBVMBTADXSULSQ-UHFFFAOYSA-M |
| XLogP | -4.00 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate (CID 155978283) is potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate is CCc1nnc(C(=O)[O-])o1.[K+].
What is the InChIKey of potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is FBVMBTADXSULSQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H6N2O3.K/c1-2-3-6-7-4(10-3)5(8)9;/h2H2,1H3,(H,8,9);/q;+1/p-1.
What are the key properties of potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate?
potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 180.20 g/mol, XLogP of -4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-ethyl-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 155978283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).