C24H34FN3O3 — CID 155979435
2-[(3S,3aR,4S,6aS)-1-[(4-fluorophenyl)methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-propan-2-ylacetamide (PubChem CID 155979435) has the molecular formula C24H34FN3O3 and a molecular weight of 431.55 g/mol. Its IUPAC name is 2-[(3S,3aR,4S,6aS)-1-[(4-fluorophenyl)methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[(3S,3aR,4S,6aS)-1-[(4-fluorophenyl)methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 155979435 |
| Molecular Formula | C24H34FN3O3 |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 2-[(3S,3aR,4S,6aS)-1-[(4-fluorophenyl)methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)C[C@@H]1CN(Cc2ccc(F)cc2)[C@@H]2CO[C@@H](CC(=O)N3CCCC3)[C@H]12 |
| InChI | InChI=1S/C24H34FN3O3/c1-16(2)26-22(29)11-18-14-28(13-17-5-7-19(25)8-6-17)20-15-31-21(24(18)20)12-23(30)27-9-3-4-10-27/h5-8,16,18,20-21,24H,3-4,9-15H2,1-2H3,(H,26,29)/t18-,20-,21+,24-/m1/s1 |
| InChIKey | ZAWLKVXGEGOBHC-ZGDJDIHISA-N |
| XLogP | 2.57 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |