C22H31FN4O4 — CID 155979326
2-[(3S,3aR,4S,6aS)-1-[(3-fluoro-4-pyridinyl)methyl]-4-[2-(2-methoxyethylamino)-2-oxoethyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide (PubChem CID 155979326) has the molecular formula C22H31FN4O4 and a molecular weight of 434.51 g/mol. Its IUPAC name is 2-[(3S,3aR,4S,6aS)-1-[(3-fluoro-4-pyridinyl)methyl]-4-[2-(2-methoxyethylamino)-2-oxoethyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide.
| Compound Name | 2-[(3S,3aR,4S,6aS)-1-[(3-fluoro-4-pyridinyl)methyl]-4-[2-(2-methoxyethylamino)-2-oxoethyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 155979326 |
| Molecular Formula | C22H31FN4O4 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2-[(3S,3aR,4S,6aS)-1-[(3-fluoro-4-pyridinyl)methyl]-4-[2-(2-methoxyethylamino)-2-oxoethyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide |
| SMILES | COCCNC(=O)C[C@@H]1OC[C@@H]2[C@H]1[C@H](CC(=O)NC1CC1)CN2Cc1ccncc1F |
| InChI | InChI=1S/C22H31FN4O4/c1-30-7-6-25-20(28)9-19-22-15(8-21(29)26-16-2-3-16)12-27(18(22)13-31-19)11-14-4-5-24-10-17(14)23/h4-5,10,15-16,18-19,22H,2-3,6-9,11-13H2,1H3,(H,25,28)(H,26,29)/t15-,18-,19+,22-/m1/s1 |
| InChIKey | DLVMNDPEZQTSLC-HCBXPFHNSA-N |
| XLogP | 0.86 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|