C19H33N3O3 — CID 155979280
2-[(3S,3aR,4S,6aS)-4-[2-oxo-2-(propan-2-ylamino)ethyl]-1-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide (PubChem CID 155979280) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-[(3S,3aR,4S,6aS)-4-[2-oxo-2-(propan-2-ylamino)ethyl]-1-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide.
| Compound Name | 2-[(3S,3aR,4S,6aS)-4-[2-oxo-2-(propan-2-ylamino)ethyl]-1-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 155979280 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 2-[(3S,3aR,4S,6aS)-4-[2-oxo-2-(propan-2-ylamino)ethyl]-1-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-N-cyclopropylacetamide |
| SMILES | CC(C)NC(=O)C[C@@H]1OC[C@@H]2[C@H]1[C@H](CC(=O)NC1CC1)CN2C(C)C |
| InChI | InChI=1S/C19H33N3O3/c1-11(2)20-18(24)8-16-19-13(7-17(23)21-14-5-6-14)9-22(12(3)4)15(19)10-25-16/h11-16,19H,5-10H2,1-4H3,(H,20,24)(H,21,23)/t13-,15-,16+,19-/m1/s1 |
| InChIKey | NHYYVGBBEYGSPE-JNNRSPCRSA-N |
| XLogP | 1.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |