C19H17ClN4O2 — CID 155979895
ethyl (Z)-3-(4-chloro-3-methyl-1-pyridin-2-yl-6,7-dihydroindazol-5-yl)-2-cyanoprop-2-enoate (PubChem CID 155979895) has the molecular formula C19H17ClN4O2 and a molecular weight of 368.82 g/mol. Its IUPAC name is ethyl (Z)-3-(4-chloro-3-methyl-1-pyridin-2-yl-6,7-dihydroindazol-5-yl)-2-cyanoprop-2-enoate.
| Compound Name | ethyl (Z)-3-(4-chloro-3-methyl-1-pyridin-2-yl-6,7-dihydroindazol-5-yl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 155979895 |
| Molecular Formula | C19H17ClN4O2 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | ethyl (Z)-3-(4-chloro-3-methyl-1-pyridin-2-yl-6,7-dihydroindazol-5-yl)-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C\C1=C(Cl)c2c(C)nn(-c3ccccn3)c2CC1 |
| InChI | InChI=1S/C19H17ClN4O2/c1-3-26-19(25)14(11-21)10-13-7-8-15-17(18(13)20)12(2)23-24(15)16-6-4-5-9-22-16/h4-6,9-10H,3,7-8H2,1-2H3/b14-10- |
| InChIKey | KATBYPRQOAMDBJ-UVTDQMKNSA-N |
| XLogP | 3.48 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|