C19H20F3N5S — CID 155982404
N'-[4-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]pyrimidin-2-yl]butane-1,4-diamine (PubChem CID 155982404) has the molecular formula C19H20F3N5S and a molecular weight of 407.47 g/mol. Its IUPAC name is N'-[4-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]pyrimidin-2-yl]butane-1,4-diamine.
| Compound Name | N'-[4-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]pyrimidin-2-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 155982404 |
| Molecular Formula | C19H20F3N5S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N'-[4-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]pyrimidin-2-yl]butane-1,4-diamine |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1-c1ccnc(NCCCCN)n1 |
| InChI | InChI=1S/C19H20F3N5S/c1-12-16(15-8-11-25-18(27-15)24-10-3-2-9-23)28-17(26-12)13-4-6-14(7-5-13)19(20,21)22/h4-8,11H,2-3,9-10,23H2,1H3,(H,24,25,27) |
| InChIKey | QPLXTTAYIZAFJC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|