C20H20F3N5O2S — CID 138805636
2-amino-5-[[4-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]pentanoic acid (PubChem CID 138805636) has the molecular formula C20H20F3N5O2S and a molecular weight of 451.47 g/mol. Its IUPAC name is 2-amino-5-[[4-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]pentanoic acid.
| Compound Name | 2-amino-5-[[4-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 138805636 |
| Molecular Formula | C20H20F3N5O2S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 2-amino-5-[[4-[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]pentanoic acid |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1-c1ccnc(NCCCC(N)C(=O)O)n1 |
| InChI | InChI=1S/C20H20F3N5O2S/c1-11-16(31-17(27-11)12-4-6-13(7-5-12)20(21,22)23)15-8-10-26-19(28-15)25-9-2-3-14(24)18(29)30/h4-8,10,14H,2-3,9,24H2,1H3,(H,29,30)(H,25,26,28) |
| InChIKey | HQIAVDQFBOHJFW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|