C15H17FN4O2 — CID 40566637
(2R)-2-amino-5-[[4-(4-fluorophenyl)pyrimidin-2-yl]amino]pentanoic acid (PubChem CID 40566637) has the molecular formula C15H17FN4O2 and a molecular weight of 304.33 g/mol. Its IUPAC name is (2R)-2-amino-5-[[4-(4-fluorophenyl)pyrimidin-2-yl]amino]pentanoic acid.
| Compound Name | (2R)-2-amino-5-[[4-(4-fluorophenyl)pyrimidin-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 40566637 |
| Molecular Formula | C15H17FN4O2 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (2R)-2-amino-5-[[4-(4-fluorophenyl)pyrimidin-2-yl]amino]pentanoic acid |
| SMILES | N[C@H](CCCNc1nccc(-c2ccc(F)cc2)n1)C(=O)O |
| InChI | InChI=1S/C15H17FN4O2/c16-11-5-3-10(4-6-11)13-7-9-19-15(20-13)18-8-1-2-12(17)14(21)22/h3-7,9,12H,1-2,8,17H2,(H,21,22)(H,18,19,20)/t12-/m1/s1 |
| InChIKey | XAXCNUYUNPPUOF-GFCCVEGCSA-N |
| XLogP | 1.89 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|