C23H25Cl2FN4 — CID 143520800
N'-[1-(2,6-dichlorophenyl)ethenyl]-N-[4-(4-fluorophenyl)pyrimidin-2-yl]propane-1,3-diamine;ethane (PubChem CID 143520800) has the molecular formula C23H25Cl2FN4 and a molecular weight of 447.39 g/mol. Its IUPAC name is N'-[1-(2,6-dichlorophenyl)ethenyl]-N-[4-(4-fluorophenyl)pyrimidin-2-yl]propane-1,3-diamine;ethane.
| Compound Name | N'-[1-(2,6-dichlorophenyl)ethenyl]-N-[4-(4-fluorophenyl)pyrimidin-2-yl]propane-1,3-diamine;ethane |
|---|---|
| PubChem CID | 143520800 |
| Molecular Formula | C23H25Cl2FN4 |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N'-[1-(2,6-dichlorophenyl)ethenyl]-N-[4-(4-fluorophenyl)pyrimidin-2-yl]propane-1,3-diamine;ethane |
| SMILES | C=C(NCCCNc1nccc(-c2ccc(F)cc2)n1)c1c(Cl)cccc1Cl.CC |
| InChI | InChI=1S/C21H19Cl2FN4.C2H6/c1-14(20-17(22)4-2-5-18(20)23)25-11-3-12-26-21-27-13-10-19(28-21)15-6-8-16(24)9-7-15;1-2/h2,4-10,13,25H,1,3,11-12H2,(H,26,27,28);1-2H3 |
| InChIKey | RDNKVLHFCWTNIF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|