C21H22FN5O2 — CID 58541626
6-[[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]hexan-1-ol (PubChem CID 58541626) has the molecular formula C21H22FN5O2 and a molecular weight of 395.44 g/mol. Its IUPAC name is 6-[[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]hexan-1-ol.
| Compound Name | 6-[[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 58541626 |
| Molecular Formula | C21H22FN5O2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 6-[[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]hexan-1-ol |
| SMILES | OCCCCCCNc1nccc(-c2c(-c3ccc(F)cc3)nc3occn23)n1 |
| InChI | InChI=1S/C21H22FN5O2/c22-16-7-5-15(6-8-16)18-19(27-12-14-29-21(27)26-18)17-9-11-24-20(25-17)23-10-3-1-2-4-13-28/h5-9,11-12,14,28H,1-4,10,13H2,(H,23,24,25) |
| InChIKey | PCIYEYFQLZEXLS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|