C19H18FN5O3 — CID 58541744
2-[2-[[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]ethoxy]ethanol (PubChem CID 58541744) has the molecular formula C19H18FN5O3 and a molecular weight of 383.38 g/mol. Its IUPAC name is 2-[2-[[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 58541744 |
| Molecular Formula | C19H18FN5O3 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[2-[[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]ethoxy]ethanol |
| SMILES | OCCOCCNc1nccc(-c2c(-c3ccc(F)cc3)nc3occn23)n1 |
| InChI | InChI=1S/C19H18FN5O3/c20-14-3-1-13(2-4-14)16-17(25-8-11-28-19(25)24-16)15-5-6-21-18(23-15)22-7-10-27-12-9-26/h1-6,8,11,26H,7,9-10,12H2,(H,21,22,23) |
| InChIKey | JDDYWQCXZONERF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|