C23H21FN6O — CID 157054344
N-[2-(4-aminophenyl)ethyl]-4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-amine;molecular hydrogen (PubChem CID 157054344) has the molecular formula C23H21FN6O and a molecular weight of 416.46 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-amine;molecular hydrogen.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-amine;molecular hydrogen |
|---|---|
| PubChem CID | 157054344 |
| Molecular Formula | C23H21FN6O |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-amine;molecular hydrogen |
| SMILES | Nc1ccc(CCNc2nccc(-c3c(-c4ccc(F)cc4)nc4occn34)n2)cc1.[H][H] |
| InChI | InChI=1S/C23H19FN6O.H2/c24-17-5-3-16(4-6-17)20-21(30-13-14-31-23(30)29-20)19-10-12-27-22(28-19)26-11-9-15-1-7-18(25)8-2-15;/h1-8,10,12-14H,9,11,25H2,(H,26,27,28);1H |
| InChIKey | AAOOTAVLGDWXFA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 94.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|