C22H19FN4O — CID 97454241
N-[(3R)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-4-pyridin-4-ylpyrimidin-2-amine (PubChem CID 97454241) has the molecular formula C22H19FN4O and a molecular weight of 374.42 g/mol. Its IUPAC name is N-[(3R)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-4-pyridin-4-ylpyrimidin-2-amine.
| Compound Name | N-[(3R)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-4-pyridin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 97454241 |
| Molecular Formula | C22H19FN4O |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[(3R)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-4-pyridin-4-ylpyrimidin-2-amine |
| SMILES | Fc1ccc([C@@H](CCNc2nccc(-c3ccncc3)n2)c2ccco2)cc1 |
| InChI | InChI=1S/C22H19FN4O/c23-18-5-3-16(4-6-18)19(21-2-1-15-28-21)9-13-25-22-26-14-10-20(27-22)17-7-11-24-12-8-17/h1-8,10-12,14-15,19H,9,13H2,(H,25,26,27)/t19-/m1/s1 |
| InChIKey | ATWPBJRLNBFYTA-LJQANCHMSA-N |
| XLogP | 4.90 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |