C11H19NO3 — CID 155982681
(5R,6R)-8-(oxetan-3-yl)-1-oxa-8-azaspiro[4.5]decan-6-ol (PubChem CID 155982681) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (5R,6R)-8-(oxetan-3-yl)-1-oxa-8-azaspiro[4.5]decan-6-ol.
| Compound Name | (5R,6R)-8-(oxetan-3-yl)-1-oxa-8-azaspiro[4.5]decan-6-ol |
|---|---|
| PubChem CID | 155982681 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (5R,6R)-8-(oxetan-3-yl)-1-oxa-8-azaspiro[4.5]decan-6-ol |
| SMILES | O[C@@H]1CN(C2COC2)CC[C@]12CCCO2 |
| InChI | InChI=1S/C11H19NO3/c13-10-6-12(9-7-14-8-9)4-3-11(10)2-1-5-15-11/h9-10,13H,1-8H2/t10-,11-/m1/s1 |
| InChIKey | HDGQNODYGQPBCN-GHMZBOCLSA-N |
| XLogP | 0.00 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |