C25H34N4O3 — CID 155994407
(3S,8R)-9-(1,5-dimethylpyrazole-3-carbonyl)-15-methyl-2-oxa-9,15-diazatricyclo[15.4.0.03,8]henicosa-1(21),17,19-trien-16-one (PubChem CID 155994407) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is (3S,8R)-9-(1,5-dimethylpyrazole-3-carbonyl)-15-methyl-2-oxa-9,15-diazatricyclo[15.4.0.03,8]henicosa-1(21),17,19-trien-16-one.
| Compound Name | (3S,8R)-9-(1,5-dimethylpyrazole-3-carbonyl)-15-methyl-2-oxa-9,15-diazatricyclo[15.4.0.03,8]henicosa-1(21),17,19-trien-16-one |
|---|---|
| PubChem CID | 155994407 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | (3S,8R)-9-(1,5-dimethylpyrazole-3-carbonyl)-15-methyl-2-oxa-9,15-diazatricyclo[15.4.0.03,8]henicosa-1(21),17,19-trien-16-one |
| SMILES | Cc1cc(C(=O)N2CCCCCN(C)C(=O)c3ccccc3O[C@H]3CCCC[C@H]32)nn1C |
| InChI | InChI=1S/C25H34N4O3/c1-18-17-20(26-28(18)3)25(31)29-16-10-4-9-15-27(2)24(30)19-11-5-7-13-22(19)32-23-14-8-6-12-21(23)29/h5,7,11,13,17,21,23H,4,6,8-10,12,14-16H2,1-3H3/t21-,23+/m1/s1 |
| InChIKey | TZDYQUPNEQQYAI-GGAORHGYSA-N |
| XLogP | 3.82 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |