C26H36N4O3 — CID 155994553
(3S,8R)-17-methyl-9-(1-methylpyrazole-4-carbonyl)-2-oxa-9,17-diazatricyclo[17.4.0.03,8]tricosa-1(23),19,21-trien-18-one (PubChem CID 155994553) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is (3S,8R)-17-methyl-9-(1-methylpyrazole-4-carbonyl)-2-oxa-9,17-diazatricyclo[17.4.0.03,8]tricosa-1(23),19,21-trien-18-one.
| Compound Name | (3S,8R)-17-methyl-9-(1-methylpyrazole-4-carbonyl)-2-oxa-9,17-diazatricyclo[17.4.0.03,8]tricosa-1(23),19,21-trien-18-one |
|---|---|
| PubChem CID | 155994553 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | (3S,8R)-17-methyl-9-(1-methylpyrazole-4-carbonyl)-2-oxa-9,17-diazatricyclo[17.4.0.03,8]tricosa-1(23),19,21-trien-18-one |
| SMILES | CN1CCCCCCCN(C(=O)c2cnn(C)c2)[C@@H]2CCCC[C@@H]2Oc2ccccc2C1=O |
| InChI | InChI=1S/C26H36N4O3/c1-28-16-10-4-3-5-11-17-30(25(31)20-18-27-29(2)19-20)22-13-7-9-15-24(22)33-23-14-8-6-12-21(23)26(28)32/h6,8,12,14,18-19,22,24H,3-5,7,9-11,13,15-17H2,1-2H3/t22-,24+/m1/s1 |
| InChIKey | HLSZOPCDWGMOKT-VWNXMTODSA-N |
| XLogP | 4.29 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |