C30H41N3O3 — CID 155994645
(3S,8R)-9-[3-(dimethylamino)benzoyl]-17-methyl-2-oxa-9,17-diazatricyclo[17.4.0.03,8]tricosa-1(23),19,21-trien-18-one (PubChem CID 155994645) has the molecular formula C30H41N3O3 and a molecular weight of 491.68 g/mol. Its IUPAC name is (3S,8R)-9-[3-(dimethylamino)benzoyl]-17-methyl-2-oxa-9,17-diazatricyclo[17.4.0.03,8]tricosa-1(23),19,21-trien-18-one.
| Compound Name | (3S,8R)-9-[3-(dimethylamino)benzoyl]-17-methyl-2-oxa-9,17-diazatricyclo[17.4.0.03,8]tricosa-1(23),19,21-trien-18-one |
|---|---|
| PubChem CID | 155994645 |
| Molecular Formula | C30H41N3O3 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | (3S,8R)-9-[3-(dimethylamino)benzoyl]-17-methyl-2-oxa-9,17-diazatricyclo[17.4.0.03,8]tricosa-1(23),19,21-trien-18-one |
| SMILES | CN1CCCCCCCN(C(=O)c2cccc(N(C)C)c2)[C@@H]2CCCC[C@@H]2Oc2ccccc2C1=O |
| InChI | InChI=1S/C30H41N3O3/c1-31(2)24-15-13-14-23(22-24)29(34)33-21-12-6-4-5-11-20-32(3)30(35)25-16-7-9-18-27(25)36-28-19-10-8-17-26(28)33/h7,9,13-16,18,22,26,28H,4-6,8,10-12,17,19-21H2,1-3H3/t26-,28+/m1/s1 |
| InChIKey | UXEDJMLLGLJAPU-IAPPQJPRSA-N |
| XLogP | 5.62 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |