C25H41N3O6 — CID 155995745
2-[(12S,13S,14S)-10-acetyl-13,14-dihydroxy-12-methoxy-1-oxa-6,10-diazacyclopentadec-6-yl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 155995745) has the molecular formula C25H41N3O6 and a molecular weight of 479.62 g/mol. Its IUPAC name is 2-[(12S,13S,14S)-10-acetyl-13,14-dihydroxy-12-methoxy-1-oxa-6,10-diazacyclopentadec-6-yl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[(12S,13S,14S)-10-acetyl-13,14-dihydroxy-12-methoxy-1-oxa-6,10-diazacyclopentadec-6-yl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 155995745 |
| Molecular Formula | C25H41N3O6 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | 2-[(12S,13S,14S)-10-acetyl-13,14-dihydroxy-12-methoxy-1-oxa-6,10-diazacyclopentadec-6-yl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | CO[C@H]1CN(C(C)=O)CCCN(CC(=O)Nc2cccc(C)c2C)CCCCOC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H41N3O6/c1-18-9-7-10-21(19(18)2)26-24(31)16-27-11-5-6-14-34-17-22(30)25(32)23(33-4)15-28(20(3)29)13-8-12-27/h7,9-10,22-23,25,30,32H,5-6,8,11-17H2,1-4H3,(H,26,31)/t22-,23-,25-/m0/s1 |
| InChIKey | XQNYYQBRIQYLLW-LSQMVHIFSA-N |
| XLogP | 1.33 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |