C36H55N3O7 — CID 155995865
1-[(7S,8S,12S,13S,14S)-10-acetyl-13,14-dihydroxy-12-methoxy-7-(3-methoxyphenyl)-8-propan-2-yl-1-oxa-6,10-diazacyclopentadec-6-yl]-2-[2-(2-methylphenyl)ethylamino]ethanone (PubChem CID 155995865) has the molecular formula C36H55N3O7 and a molecular weight of 641.85 g/mol. Its IUPAC name is 1-[(7S,8S,12S,13S,14S)-10-acetyl-13,14-dihydroxy-12-methoxy-7-(3-methoxyphenyl)-8-propan-2-yl-1-oxa-6,10-diazacyclopentadec-6-yl]-2-[2-(2-methylphenyl)ethylamino]ethanone.
| Compound Name | 1-[(7S,8S,12S,13S,14S)-10-acetyl-13,14-dihydroxy-12-methoxy-7-(3-methoxyphenyl)-8-propan-2-yl-1-oxa-6,10-diazacyclopentadec-6-yl]-2-[2-(2-methylphenyl)ethylamino]ethanone |
|---|---|
| PubChem CID | 155995865 |
| Molecular Formula | C36H55N3O7 |
| Molecular Weight | 641.85 g/mol |
| Exact Mass | 641.40 |
| IUPAC Name | 1-[(7S,8S,12S,13S,14S)-10-acetyl-13,14-dihydroxy-12-methoxy-7-(3-methoxyphenyl)-8-propan-2-yl-1-oxa-6,10-diazacyclopentadec-6-yl]-2-[2-(2-methylphenyl)ethylamino]ethanone |
| SMILES | COc1cccc([C@@H]2[C@@H](C(C)C)CN(C(C)=O)C[C@H](OC)[C@@H](O)[C@@H](O)COCCCCN2C(=O)CNCCc2ccccc2C)c1 |
| InChI | InChI=1S/C36H55N3O7/c1-25(2)31-22-38(27(4)40)23-33(45-6)36(43)32(41)24-46-19-10-9-18-39(35(31)29-14-11-15-30(20-29)44-5)34(42)21-37-17-16-28-13-8-7-12-26(28)3/h7-8,11-15,20,25,31-33,35-37,41,43H,9-10,16-19,21-24H2,1-6H3/t31-,32+,33+,35-,36+/m1/s1 |
| InChIKey | SJLGJIWXELCKTO-HTQIHCHASA-N |
| XLogP | 3.37 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|