C16H22FNO5 — CID 155996183
N-[[(3R,4S,5R)-4,5-dimethoxyoxan-3-yl]methyl]-2-fluoro-3-methoxybenzamide (PubChem CID 155996183) has the molecular formula C16H22FNO5 and a molecular weight of 327.35 g/mol. Its IUPAC name is N-[[(3R,4S,5R)-4,5-dimethoxyoxan-3-yl]methyl]-2-fluoro-3-methoxybenzamide.
| Compound Name | N-[[(3R,4S,5R)-4,5-dimethoxyoxan-3-yl]methyl]-2-fluoro-3-methoxybenzamide |
|---|---|
| PubChem CID | 155996183 |
| Molecular Formula | C16H22FNO5 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[[(3R,4S,5R)-4,5-dimethoxyoxan-3-yl]methyl]-2-fluoro-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC[C@@H]2COC[C@@H](OC)[C@H]2OC)c1F |
| InChI | InChI=1S/C16H22FNO5/c1-20-12-6-4-5-11(14(12)17)16(19)18-7-10-8-23-9-13(21-2)15(10)22-3/h4-6,10,13,15H,7-9H2,1-3H3,(H,18,19)/t10-,13-,15+/m1/s1 |
| InChIKey | BAIUKZKYAXEDJS-YVLXSGLVSA-N |
| XLogP | 1.24 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |