C18H22N2O5 — CID 175655125
N-[[(3R,4S,5R)-4,5-dimethoxyoxan-3-yl]methyl]-2-oxo-1H-quinoline-3-carboxamide (PubChem CID 175655125) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-[[(3R,4S,5R)-4,5-dimethoxyoxan-3-yl]methyl]-2-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[[(3R,4S,5R)-4,5-dimethoxyoxan-3-yl]methyl]-2-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 175655125 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[[(3R,4S,5R)-4,5-dimethoxyoxan-3-yl]methyl]-2-oxo-1H-quinoline-3-carboxamide |
| SMILES | CO[C@H]1[C@H](CNC(=O)c2cc3ccccc3[nH]c2=O)COC[C@H]1OC |
| InChI | InChI=1S/C18H22N2O5/c1-23-15-10-25-9-12(16(15)24-2)8-19-17(21)13-7-11-5-3-4-6-14(11)20-18(13)22/h3-7,12,15-16H,8-10H2,1-2H3,(H,19,21)(H,20,22)/t12-,15-,16+/m1/s1 |
| InChIKey | NJFNQFROFJAFDW-WQVCFCJDSA-N |
| XLogP | 0.93 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |