C28H53N3O7 — CID 155997464
1-[(7R,11R,12R,13R)-9-acetyl-12,13-dihydroxy-11-methoxy-7-(2-methylpropyl)-1-oxa-6,9-diazacyclotetradec-6-yl]-2-[oxolan-2-ylmethyl(propyl)amino]ethanone (PubChem CID 155997464) has the molecular formula C28H53N3O7 and a molecular weight of 543.75 g/mol. Its IUPAC name is 1-[(7R,11R,12R,13R)-9-acetyl-12,13-dihydroxy-11-methoxy-7-(2-methylpropyl)-1-oxa-6,9-diazacyclotetradec-6-yl]-2-[oxolan-2-ylmethyl(propyl)amino]ethanone.
| Compound Name | 1-[(7R,11R,12R,13R)-9-acetyl-12,13-dihydroxy-11-methoxy-7-(2-methylpropyl)-1-oxa-6,9-diazacyclotetradec-6-yl]-2-[oxolan-2-ylmethyl(propyl)amino]ethanone |
|---|---|
| PubChem CID | 155997464 |
| Molecular Formula | C28H53N3O7 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.39 |
| IUPAC Name | 1-[(7R,11R,12R,13R)-9-acetyl-12,13-dihydroxy-11-methoxy-7-(2-methylpropyl)-1-oxa-6,9-diazacyclotetradec-6-yl]-2-[oxolan-2-ylmethyl(propyl)amino]ethanone |
| SMILES | CCCN(CC(=O)N1CCCCOC[C@@H](O)[C@@H](O)[C@H](OC)CN(C(C)=O)C[C@H]1CC(C)C)CC1CCCO1 |
| InChI | InChI=1S/C28H53N3O7/c1-6-11-29(17-24-10-9-14-38-24)19-27(34)31-12-7-8-13-37-20-25(33)28(35)26(36-5)18-30(22(4)32)16-23(31)15-21(2)3/h21,23-26,28,33,35H,6-20H2,1-5H3/t23-,24?,25-,26-,28-/m1/s1 |
| InChIKey | MZSRZTFPWGSDCD-BIGZWIPNSA-N |
| XLogP | 1.52 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |