C21H27FN2O5 — CID 155997626
[1-(4-fluorobenzoyl)-4-(2-morpholin-4-yl-2-oxoethyl)piperidin-4-yl]methyl acetate (PubChem CID 155997626) has the molecular formula C21H27FN2O5 and a molecular weight of 406.45 g/mol. Its IUPAC name is [1-(4-fluorobenzoyl)-4-(2-morpholin-4-yl-2-oxoethyl)piperidin-4-yl]methyl acetate.
| Compound Name | [1-(4-fluorobenzoyl)-4-(2-morpholin-4-yl-2-oxoethyl)piperidin-4-yl]methyl acetate |
|---|---|
| PubChem CID | 155997626 |
| Molecular Formula | C21H27FN2O5 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [1-(4-fluorobenzoyl)-4-(2-morpholin-4-yl-2-oxoethyl)piperidin-4-yl]methyl acetate |
| SMILES | CC(=O)OCC1(CC(=O)N2CCOCC2)CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H27FN2O5/c1-16(25)29-15-21(14-19(26)23-10-12-28-13-11-23)6-8-24(9-7-21)20(27)17-2-4-18(22)5-3-17/h2-5H,6-15H2,1H3 |
| InChIKey | MZJHWCUZSUSTBZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |