C20H27N3O4 — CID 17479505
4-[[2-[1-(2-morpholin-4-yl-2-oxoethyl)cyclopentyl]acetyl]amino]benzamide (PubChem CID 17479505) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 4-[[2-[1-(2-morpholin-4-yl-2-oxoethyl)cyclopentyl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[1-(2-morpholin-4-yl-2-oxoethyl)cyclopentyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17479505 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-[[2-[1-(2-morpholin-4-yl-2-oxoethyl)cyclopentyl]acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CC2(CC(=O)N3CCOCC3)CCCC2)cc1 |
| InChI | InChI=1S/C20H27N3O4/c21-19(26)15-3-5-16(6-4-15)22-17(24)13-20(7-1-2-8-20)14-18(25)23-9-11-27-12-10-23/h3-6H,1-2,7-14H2,(H2,21,26)(H,22,24) |
| InChIKey | DWMPSWVHDXJHRS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |