C20H23FN2OS — CID 155999302
[(3aR,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-thiophen-2-ylmethanone (PubChem CID 155999302) has the molecular formula C20H23FN2OS and a molecular weight of 358.48 g/mol. Its IUPAC name is [(3aR,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-thiophen-2-ylmethanone.
| Compound Name | [(3aR,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 155999302 |
| Molecular Formula | C20H23FN2OS |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [(3aR,7aS)-1-(4-fluorophenyl)-2,2-dimethyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-thiophen-2-ylmethanone |
| SMILES | CC1(C)C[C@@H]2CN(C(=O)c3cccs3)CC[C@@H]2N1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN2OS/c1-20(2)12-14-13-22(19(24)18-4-3-11-25-18)10-9-17(14)23(20)16-7-5-15(21)6-8-16/h3-8,11,14,17H,9-10,12-13H2,1-2H3/t14-,17+/m1/s1 |
| InChIKey | ACVDJKCSYZMXRN-PBHICJAKSA-N |
| XLogP | 4.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |