C17H16N2O6S2 — CID 15602704
S-[2-[6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-pyridinyl]-2-oxoethyl] ethanethioate (PubChem CID 15602704) has the molecular formula C17H16N2O6S2 and a molecular weight of 408.46 g/mol. Its IUPAC name is S-[2-[6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-pyridinyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-pyridinyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 15602704 |
| Molecular Formula | C17H16N2O6S2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | S-[2-[6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-pyridinyl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(NS(=O)(=O)c2ccc3c(c2)OCCO3)nc1 |
| InChI | InChI=1S/C17H16N2O6S2/c1-11(20)26-10-14(21)12-2-5-17(18-9-12)19-27(22,23)13-3-4-15-16(8-13)25-7-6-24-15/h2-5,8-9H,6-7,10H2,1H3,(H,18,19) |
| InChIKey | IUKCGKDQBUASFM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|