C22H27N3O5S2 — CID 87814433
S-[2-oxo-2-[6-[[4-(2-piperidin-2-ylethoxy)phenyl]sulfonylamino]-3-pyridinyl]ethyl] ethanethioate (PubChem CID 87814433) has the molecular formula C22H27N3O5S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is S-[2-oxo-2-[6-[[4-(2-piperidin-2-ylethoxy)phenyl]sulfonylamino]-3-pyridinyl]ethyl] ethanethioate.
| Compound Name | S-[2-oxo-2-[6-[[4-(2-piperidin-2-ylethoxy)phenyl]sulfonylamino]-3-pyridinyl]ethyl] ethanethioate |
|---|---|
| PubChem CID | 87814433 |
| Molecular Formula | C22H27N3O5S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | S-[2-oxo-2-[6-[[4-(2-piperidin-2-ylethoxy)phenyl]sulfonylamino]-3-pyridinyl]ethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(NS(=O)(=O)c2ccc(OCCC3CCCCN3)cc2)nc1 |
| InChI | InChI=1S/C22H27N3O5S2/c1-16(26)31-15-21(27)17-5-10-22(24-14-17)25-32(28,29)20-8-6-19(7-9-20)30-13-11-18-4-2-3-12-23-18/h5-10,14,18,23H,2-4,11-13,15H2,1H3,(H,24,25) |
| InChIKey | QCMAKFLHYLOZKJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|