C19H23N3O5S2 — CID 58896362
S-[2-[6-[[3-[2-(dimethylamino)ethoxy]phenyl]sulfonylamino]-3-pyridinyl]-2-oxoethyl] ethanethioate (PubChem CID 58896362) has the molecular formula C19H23N3O5S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is S-[2-[6-[[3-[2-(dimethylamino)ethoxy]phenyl]sulfonylamino]-3-pyridinyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[6-[[3-[2-(dimethylamino)ethoxy]phenyl]sulfonylamino]-3-pyridinyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 58896362 |
| Molecular Formula | C19H23N3O5S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | S-[2-[6-[[3-[2-(dimethylamino)ethoxy]phenyl]sulfonylamino]-3-pyridinyl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(NS(=O)(=O)c2cccc(OCCN(C)C)c2)nc1 |
| InChI | InChI=1S/C19H23N3O5S2/c1-14(23)28-13-18(24)15-7-8-19(20-12-15)21-29(25,26)17-6-4-5-16(11-17)27-10-9-22(2)3/h4-8,11-12H,9-10,13H2,1-3H3,(H,20,21) |
| InChIKey | DFEPYWZPUISPCV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|