C22H29N3O6S2 — CID 58896373
S-[2-[6-[[3-[4-(dimethylamino)butoxy]-4-methoxyphenyl]sulfonylamino]-3-pyridinyl]-2-oxoethyl] ethanethioate (PubChem CID 58896373) has the molecular formula C22H29N3O6S2 and a molecular weight of 495.62 g/mol. Its IUPAC name is S-[2-[6-[[3-[4-(dimethylamino)butoxy]-4-methoxyphenyl]sulfonylamino]-3-pyridinyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[6-[[3-[4-(dimethylamino)butoxy]-4-methoxyphenyl]sulfonylamino]-3-pyridinyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 58896373 |
| Molecular Formula | C22H29N3O6S2 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | S-[2-[6-[[3-[4-(dimethylamino)butoxy]-4-methoxyphenyl]sulfonylamino]-3-pyridinyl]-2-oxoethyl] ethanethioate |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(C(=O)CSC(C)=O)cn2)cc1OCCCCN(C)C |
| InChI | InChI=1S/C22H29N3O6S2/c1-16(26)32-15-19(27)17-7-10-22(23-14-17)24-33(28,29)18-8-9-20(30-4)21(13-18)31-12-6-5-11-25(2)3/h7-10,13-14H,5-6,11-12,15H2,1-4H3,(H,23,24) |
| InChIKey | OYFRDDRNLBLHNG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|