C24H48O2Si2 — CID 15605929
triethyl-[(1Z,3S,4S)-1-ethylidene-2,2,4-trimethyl-3-triethylsilyloxyhept-5-ynoxy]silane (PubChem CID 15605929) has the molecular formula C24H48O2Si2 and a molecular weight of 424.82 g/mol. Its IUPAC name is triethyl-[(1Z,3S,4S)-1-ethylidene-2,2,4-trimethyl-3-triethylsilyloxyhept-5-ynoxy]silane.
| Compound Name | triethyl-[(1Z,3S,4S)-1-ethylidene-2,2,4-trimethyl-3-triethylsilyloxyhept-5-ynoxy]silane |
|---|---|
| PubChem CID | 15605929 |
| Molecular Formula | C24H48O2Si2 |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | triethyl-[(1Z,3S,4S)-1-ethylidene-2,2,4-trimethyl-3-triethylsilyloxyhept-5-ynoxy]silane |
| SMILES | CC#C[C@H](C)[C@H](O[Si](CC)(CC)CC)C(C)(C)/C(=C/C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H48O2Si2/c1-12-20-21(9)23(26-28(17-6,18-7)19-8)24(10,11)22(13-2)25-27(14-3,15-4)16-5/h13,21,23H,14-19H2,1-11H3/b22-13-/t21-,23-/m0/s1 |
| InChIKey | BOSXAJLMQGTUSC-TXVFOLKNSA-N |
| XLogP | 7.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|