C26H54O2Si3 — CID 11123708
[(E,5R,6R,7S)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7-trimethyloct-3-en-1-ynyl]-trimethylsilane (PubChem CID 11123708) has the molecular formula C26H54O2Si3 and a molecular weight of 482.97 g/mol. Its IUPAC name is [(E,5R,6R,7S)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7-trimethyloct-3-en-1-ynyl]-trimethylsilane.
| Compound Name | [(E,5R,6R,7S)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7-trimethyloct-3-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11123708 |
| Molecular Formula | C26H54O2Si3 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | [(E,5R,6R,7S)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7-trimethyloct-3-en-1-ynyl]-trimethylsilane |
| SMILES | C/C(C#C[Si](C)(C)C)=C\[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H54O2Si3/c1-21(17-18-29(10,11)12)19-22(2)24(28-31(15,16)26(7,8)9)23(3)20-27-30(13,14)25(4,5)6/h19,22-24H,20H2,1-16H3/b21-19+/t22-,23+,24-/m1/s1 |
| InChIKey | ZPTYKYNXKBJHNE-JJNSXUJOSA-N |
| XLogP | 8.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|