C16H30OSi2 — CID 56850984
tert-butyl-dimethyl-[(1R,2S)-2-(2-trimethylsilylethynyl)cyclopent-3-en-1-yl]oxysilane (PubChem CID 56850984) has the molecular formula C16H30OSi2 and a molecular weight of 294.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,2S)-2-(2-trimethylsilylethynyl)cyclopent-3-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,2S)-2-(2-trimethylsilylethynyl)cyclopent-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 56850984 |
| Molecular Formula | C16H30OSi2 |
| Molecular Weight | 294.59 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,2S)-2-(2-trimethylsilylethynyl)cyclopent-3-en-1-yl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC=C[C@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C16H30OSi2/c1-16(2,3)19(7,8)17-15-11-9-10-14(15)12-13-18(4,5)6/h9-10,14-15H,11H2,1-8H3/t14-,15+/m0/s1 |
| InChIKey | YJQDLSCEBUUVSJ-LSDHHAIUSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|