C14H26OSi — CID 54417522
tert-butyl-dimethyl-[(3R,4R)-4-methylhept-5-en-1-yn-3-yl]oxysilane (PubChem CID 54417522) has the molecular formula C14H26OSi and a molecular weight of 238.45 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R,4R)-4-methylhept-5-en-1-yn-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3R,4R)-4-methylhept-5-en-1-yn-3-yl]oxysilane |
|---|---|
| PubChem CID | 54417522 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | tert-butyl-dimethyl-[(3R,4R)-4-methylhept-5-en-1-yn-3-yl]oxysilane |
| SMILES | C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=CC |
| InChI | InChI=1S/C14H26OSi/c1-9-11-12(3)13(10-2)15-16(7,8)14(4,5)6/h2,9,11-13H,1,3-8H3/t12-,13+/m1/s1 |
| InChIKey | VYMGLBFAIDXTGD-OLZOCXBDSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|