C16H32O3Si — CID 15609446
(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-ol (PubChem CID 15609446) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is (1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-ol.
| Compound Name | (1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 15609446 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-ol |
| SMILES | CC(C)(C)OC[C@]1(O)C=C[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C16H32O3Si/c1-14(2,3)18-12-16(17)10-9-13(11-16)19-20(7,8)15(4,5)6/h9-10,13,17H,11-12H2,1-8H3/t13-,16-/m0/s1 |
| InChIKey | NBLFURHPYWFTAY-BBRMVZONSA-N |
| XLogP | 3.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|