C23H24BrN5O5 — CID 15617208
2-[2-(4-bromophenyl)imidazo[4,5-b]pyridin-3-yl]-1-(4-methylpiperazin-1-yl)ethanone;(E)-but-2-enedioic acid (PubChem CID 15617208) has the molecular formula C23H24BrN5O5 and a molecular weight of 530.38 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)imidazo[4,5-b]pyridin-3-yl]-1-(4-methylpiperazin-1-yl)ethanone;(E)-but-2-enedioic acid.
| Compound Name | 2-[2-(4-bromophenyl)imidazo[4,5-b]pyridin-3-yl]-1-(4-methylpiperazin-1-yl)ethanone;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 15617208 |
| Molecular Formula | C23H24BrN5O5 |
| Molecular Weight | 530.38 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 2-[2-(4-bromophenyl)imidazo[4,5-b]pyridin-3-yl]-1-(4-methylpiperazin-1-yl)ethanone;(E)-but-2-enedioic acid |
| SMILES | CN1CCN(C(=O)Cn2c(-c3ccc(Br)cc3)nc3cccnc32)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H20BrN5O.C4H4O4/c1-23-9-11-24(12-10-23)17(26)13-25-18(14-4-6-15(20)7-5-14)22-16-3-2-8-21-19(16)25;5-3(6)1-2-4(7)8/h2-8H,9-13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | UXGWLXXOZQGFCI-WLHGVMLRSA-N |
| XLogP | 2.35 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|