C24H18N4O2 — CID 15620161
2,3-bis(4-methoxyphenyl)pyrazino[2,3-f]quinoxaline (PubChem CID 15620161) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2,3-bis(4-methoxyphenyl)pyrazino[2,3-f]quinoxaline.
| Compound Name | 2,3-bis(4-methoxyphenyl)pyrazino[2,3-f]quinoxaline |
|---|---|
| PubChem CID | 15620161 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2,3-bis(4-methoxyphenyl)pyrazino[2,3-f]quinoxaline |
| SMILES | COc1ccc(-c2nc3ccc4nccnc4c3nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H18N4O2/c1-29-17-7-3-15(4-8-17)21-22(16-5-9-18(30-2)10-6-16)28-24-20(27-21)12-11-19-23(24)26-14-13-25-19/h3-14H,1-2H3 |
| InChIKey | ZNRZWAHMXDDZEN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|