C36H44Br2N2O2 — CID 174756097
5,6-dibromo-2,3-bis(4-octoxyphenyl)quinoxaline (PubChem CID 174756097) has the molecular formula C36H44Br2N2O2 and a molecular weight of 696.57 g/mol. Its IUPAC name is 5,6-dibromo-2,3-bis(4-octoxyphenyl)quinoxaline.
| Compound Name | 5,6-dibromo-2,3-bis(4-octoxyphenyl)quinoxaline |
|---|---|
| PubChem CID | 174756097 |
| Molecular Formula | C36H44Br2N2O2 |
| Molecular Weight | 696.57 g/mol |
| Exact Mass | 694.18 |
| IUPAC Name | 5,6-dibromo-2,3-bis(4-octoxyphenyl)quinoxaline |
| SMILES | CCCCCCCCOc1ccc(-c2nc3ccc(Br)c(Br)c3nc2-c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C36H44Br2N2O2/c1-3-5-7-9-11-13-25-41-29-19-15-27(16-20-29)34-35(40-36-32(39-34)24-23-31(37)33(36)38)28-17-21-30(22-18-28)42-26-14-12-10-8-6-4-2/h15-24H,3-14,25-26H2,1-2H3 |
| InChIKey | JFRWCQLROIFODT-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.57 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|