C28H28Br2N2O — CID 71294579
5,8-dibromo-2-(4-butoxyphenyl)-3-(4-butylphenyl)quinoxaline (PubChem CID 71294579) has the molecular formula C28H28Br2N2O and a molecular weight of 568.35 g/mol. Its IUPAC name is 5,8-dibromo-2-(4-butoxyphenyl)-3-(4-butylphenyl)quinoxaline.
| Compound Name | 5,8-dibromo-2-(4-butoxyphenyl)-3-(4-butylphenyl)quinoxaline |
|---|---|
| PubChem CID | 71294579 |
| Molecular Formula | C28H28Br2N2O |
| Molecular Weight | 568.35 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | 5,8-dibromo-2-(4-butoxyphenyl)-3-(4-butylphenyl)quinoxaline |
| SMILES | CCCCOc1ccc(-c2nc3c(Br)ccc(Br)c3nc2-c2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C28H28Br2N2O/c1-3-5-7-19-8-10-20(11-9-19)25-26(21-12-14-22(15-13-21)33-18-6-4-2)32-28-24(30)17-16-23(29)27(28)31-25/h8-17H,3-7,18H2,1-2H3 |
| InChIKey | LTSUJMVDNKBEBX-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.35 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|