C20H22Br2N2O — CID 102108778
4,7-dibromo-2-(4-hexoxyphenyl)-1-methylbenzimidazole (PubChem CID 102108778) has the molecular formula C20H22Br2N2O and a molecular weight of 466.22 g/mol. Its IUPAC name is 4,7-dibromo-2-(4-hexoxyphenyl)-1-methylbenzimidazole.
| Compound Name | 4,7-dibromo-2-(4-hexoxyphenyl)-1-methylbenzimidazole |
|---|---|
| PubChem CID | 102108778 |
| Molecular Formula | C20H22Br2N2O |
| Molecular Weight | 466.22 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | 4,7-dibromo-2-(4-hexoxyphenyl)-1-methylbenzimidazole |
| SMILES | CCCCCCOc1ccc(-c2nc3c(Br)ccc(Br)c3n2C)cc1 |
| InChI | InChI=1S/C20H22Br2N2O/c1-3-4-5-6-13-25-15-9-7-14(8-10-15)20-23-18-16(21)11-12-17(22)19(18)24(20)2/h7-12H,3-6,13H2,1-2H3 |
| InChIKey | IPOOSXKDBIXSFJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.22 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|