C26H30O2Si — CID 15622142
[3-[3-[(4-ethoxyphenyl)-dimethylsilyl]propyl]phenyl]-phenylmethanone (PubChem CID 15622142) has the molecular formula C26H30O2Si and a molecular weight of 402.61 g/mol. Its IUPAC name is [3-[3-[(4-ethoxyphenyl)-dimethylsilyl]propyl]phenyl]-phenylmethanone.
| Compound Name | [3-[3-[(4-ethoxyphenyl)-dimethylsilyl]propyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 15622142 |
| Molecular Formula | C26H30O2Si |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [3-[3-[(4-ethoxyphenyl)-dimethylsilyl]propyl]phenyl]-phenylmethanone |
| SMILES | CCOc1ccc([Si](C)(C)CCCc2cccc(C(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H30O2Si/c1-4-28-24-15-17-25(18-16-24)29(2,3)19-9-11-21-10-8-14-23(20-21)26(27)22-12-6-5-7-13-22/h5-8,10,12-18,20H,4,9,11,19H2,1-3H3 |
| InChIKey | WQHGRMQQWQIBQX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|