C19H21F5OSi — CID 14601760
(4-ethoxyphenyl)-dimethyl-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silane (PubChem CID 14601760) has the molecular formula C19H21F5OSi and a molecular weight of 388.45 g/mol. Its IUPAC name is (4-ethoxyphenyl)-dimethyl-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silane.
| Compound Name | (4-ethoxyphenyl)-dimethyl-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silane |
|---|---|
| PubChem CID | 14601760 |
| Molecular Formula | C19H21F5OSi |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (4-ethoxyphenyl)-dimethyl-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silane |
| SMILES | CCOc1ccc([Si](C)(C)CCCc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H21F5OSi/c1-4-25-12-7-9-13(10-8-12)26(2,3)11-5-6-14-15(20)17(22)19(24)18(23)16(14)21/h7-10H,4-6,11H2,1-3H3 |
| InChIKey | IXGNGGPNRHNMJF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|