About 1-ethoxy-4-ethoxybenzene
1-ethoxy-4-ethoxybenzene (PubChem CID 91392612) has the molecular formula C10H13O2-
and a molecular weight of 165.21 g/mol. Its IUPAC name is 1-ethoxy-4-ethoxybenzene.
Molecular Properties
| Compound Name | 1-ethoxy-4-ethoxybenzene |
| PubChem CID | 91392612 |
| Molecular Formula | C10H13O2- |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 1-ethoxy-4-ethoxybenzene |
| SMILES | C[CH-]Oc1ccc(OCC)cc1 |
| InChI | InChI=1S/C10H13O2/c1-3-11-9-5-7-10(8-6-9)12-4-2/h3,5-8H,4H2,1-2H3/q-1 |
| InChIKey | PBULAPOHEYBSCX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-4-ethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-4-ethoxybenzene?
The IUPAC name of 1-ethoxy-4-ethoxybenzene (CID 91392612) is 1-ethoxy-4-ethoxybenzene.
What is the SMILES notation for 1-ethoxy-4-ethoxybenzene?
The canonical SMILES for 1-ethoxy-4-ethoxybenzene is C[CH-]Oc1ccc(OCC)cc1.
What is the InChIKey of 1-ethoxy-4-ethoxybenzene?
The InChIKey is PBULAPOHEYBSCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13O2/c1-3-11-9-5-7-10(8-6-9)12-4-2/h3,5-8H,4H2,1-2H3/q-1.
What are the key properties of 1-ethoxy-4-ethoxybenzene?
1-ethoxy-4-ethoxybenzene has a molecular weight of 165.21 g/mol, XLogP of 2.65, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-4-ethoxybenzene is sourced from PubChem (CID 91392612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).