C16H16ClN3 — CID 15629773
(6R)-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-amine;hydrochloride (PubChem CID 15629773) has the molecular formula C16H16ClN3 and a molecular weight of 285.78 g/mol. Its IUPAC name is (6R)-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-amine;hydrochloride.
| Compound Name | (6R)-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-amine;hydrochloride |
|---|---|
| PubChem CID | 15629773 |
| Molecular Formula | C16H16ClN3 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (6R)-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-amine;hydrochloride |
| SMILES | Cl.NC1=NC[C@H]2c3ccccc3Cc3ccccc3N12 |
| InChI | InChI=1S/C16H15N3.ClH/c17-16-18-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)19(15)16;/h1-8,15H,9-10H2,(H2,17,18);1H/t15-;/m0./s1 |
| InChIKey | VKXSGUIOOQPGAF-RSAXXLAASA-N |
| XLogP | 2.89 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |