C17H18N2 — CID 21420493
2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-amine (PubChem CID 21420493) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-amine.
| Compound Name | 2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-amine |
|---|---|
| PubChem CID | 21420493 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7,9,11,14,16-hexaen-4-amine |
| SMILES | NC1CC2c3ccccc3Cc3ccccc3N2C1 |
| InChI | InChI=1S/C17H18N2/c18-14-10-17-15-7-3-1-5-12(15)9-13-6-2-4-8-16(13)19(17)11-14/h1-8,14,17H,9-11,18H2 |
| InChIKey | JOVGOSMCZSJBLG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |