C17H19ClN2 — CID 163322111
3,3,4,4-tetradeuterio-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;hydrochloride (PubChem CID 163322111) has the molecular formula C17H19ClN2 and a molecular weight of 290.83 g/mol. Its IUPAC name is 3,3,4,4-tetradeuterio-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;hydrochloride.
| Compound Name | 3,3,4,4-tetradeuterio-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;hydrochloride |
|---|---|
| PubChem CID | 163322111 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 290.83 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3,3,4,4-tetradeuterio-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;hydrochloride |
| SMILES | Cl.[2H]C1([2H])NCC2c3ccccc3Cc3ccccc3N2C1([2H])[2H] |
| InChI | InChI=1S/C17H18N2.ClH/c1-3-7-15-13(5-1)11-14-6-2-4-8-16(14)19-10-9-18-12-17(15)19;/h1-8,17-18H,9-12H2;1H/i9D2,10D2; |
| InChIKey | KVJGBZBVKLKGRN-PQDNHERISA-N |
| XLogP | 3.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.83 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |