C20H23K2N6O5P — CID 68916236
dipotassium;2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-amine;2-[methyl-(N'-phosphonatocarbamimidoyl)amino]acetic acid (PubChem CID 68916236) has the molecular formula C20H23K2N6O5P and a molecular weight of 536.61 g/mol. Its IUPAC name is dipotassium;2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-amine;2-[methyl-(N'-phosphonatocarbamimidoyl)amino]acetic acid.
| Compound Name | dipotassium;2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-amine;2-[methyl-(N'-phosphonatocarbamimidoyl)amino]acetic acid |
|---|---|
| PubChem CID | 68916236 |
| Molecular Formula | C20H23K2N6O5P |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | dipotassium;2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-amine;2-[methyl-(N'-phosphonatocarbamimidoyl)amino]acetic acid |
| SMILES | CN(CC(=O)O)C(N)=NP(=O)([O-])[O-].NC1=NCC2c3ccccc3Cc3ccccc3N12.[K+].[K+] |
| InChI | InChI=1S/C16H15N3.C4H10N3O5P.2K/c17-16-18-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)19(15)16;1-7(2-3(8)9)4(5)6-13(10,11)12;;/h1-8,15H,9-10H2,(H2,17,18);2H2,1H3,(H,8,9)(H4,5,6,10,11,12);;/q;;2*+1/p-2 |
| InChIKey | ONKKBUDEBUODCE-UHFFFAOYSA-L |
| XLogP | -6.38 |
| TPSA | 183.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | -6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|