C32H38N4O5S2 — CID 88987506
2-[2-(2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-ylcarbamoyloxy)ethyldisulfanyl]ethyl N-[(1S,2S)-1-cyclohexa-2,4-dien-1-yl-1-hydroxypropan-2-yl]-N-methylcarbamate (PubChem CID 88987506) has the molecular formula C32H38N4O5S2 and a molecular weight of 622.81 g/mol. Its IUPAC name is 2-[2-(2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-ylcarbamoyloxy)ethyldisulfanyl]ethyl N-[(1S,2S)-1-cyclohexa-2,4-dien-1-yl-1-hydroxypropan-2-yl]-N-methylcarbamate.
| Compound Name | 2-[2-(2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-ylcarbamoyloxy)ethyldisulfanyl]ethyl N-[(1S,2S)-1-cyclohexa-2,4-dien-1-yl-1-hydroxypropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 88987506 |
| Molecular Formula | C32H38N4O5S2 |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | 2-[2-(2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-ylcarbamoyloxy)ethyldisulfanyl]ethyl N-[(1S,2S)-1-cyclohexa-2,4-dien-1-yl-1-hydroxypropan-2-yl]-N-methylcarbamate |
| SMILES | C[C@@H]([C@@H](O)C1C=CC=CC1)N(C)C(=O)OCCSSCCOC(=O)NC1=NCC2c3ccccc3Cc3ccccc3N12 |
| InChI | InChI=1S/C32H38N4O5S2/c1-22(29(37)23-10-4-3-5-11-23)35(2)32(39)41-17-19-43-42-18-16-40-31(38)34-30-33-21-28-26-14-8-6-12-24(26)20-25-13-7-9-15-27(25)36(28)30/h3-10,12-15,22-23,28-29,37H,11,16-21H2,1-2H3,(H,33,34,38)/t22-,23?,28?,29+/m0/s1 |
| InChIKey | HTGBRNCAGPCAMV-AXWVBKSASA-N |
| XLogP | 5.57 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|