About methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate
methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate (PubChem CID 23274511) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate |
| PubChem CID | 23274511 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate |
| SMILES | COC(=O)NC1=NCC(c2ccccc2)N1C |
| InChI | InChI=1S/C12H15N3O2/c1-15-10(9-6-4-3-5-7-9)8-13-11(15)14-12(16)17-2/h3-7,10H,8H2,1-2H3,(H,13,14,16) |
| InChIKey | SAYAMCOWJNUODI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate?
The IUPAC name of methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate (CID 23274511) is methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate.
What is the SMILES notation for methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate?
The canonical SMILES for methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate is COC(=O)NC1=NCC(c2ccccc2)N1C.
What is the InChIKey of methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate?
The InChIKey is SAYAMCOWJNUODI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c1-15-10(9-6-4-3-5-7-9)8-13-11(15)14-12(16)17-2/h3-7,10H,8H2,1-2H3,(H,13,14,16).
What are the key properties of methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate?
methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate has a molecular weight of 233.27 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(1-methyl-5-phenyl-4,5-dihydroimidazol-2-yl)carbamate is sourced from PubChem (CID 23274511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).