C18H15NO — CID 102413829
5-methyl-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),4,7,9,11,14,16-heptaen-3-one (PubChem CID 102413829) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-methyl-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),4,7,9,11,14,16-heptaen-3-one.
| Compound Name | 5-methyl-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),4,7,9,11,14,16-heptaen-3-one |
|---|---|
| PubChem CID | 102413829 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 5-methyl-2-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),4,7,9,11,14,16-heptaen-3-one |
| SMILES | CC1=CC(=O)N2c3ccccc3Cc3ccccc3C12 |
| InChI | InChI=1S/C18H15NO/c1-12-10-17(20)19-16-9-5-3-7-14(16)11-13-6-2-4-8-15(13)18(12)19/h2-10,18H,11H2,1H3 |
| InChIKey | UXONNNPSXUQPTH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |