C4H9K2N3O5P+ — CID 20844331
dipotassium;2-[methyl-[(Z)-N'-phosphonocarbamimidoyl]amino]acetate (PubChem CID 20844331) has the molecular formula C4H9K2N3O5P+ and a molecular weight of 288.30 g/mol. Its IUPAC name is dipotassium;2-[methyl-[(Z)-N'-phosphonocarbamimidoyl]amino]acetate.
| Compound Name | dipotassium;2-[methyl-[(Z)-N'-phosphonocarbamimidoyl]amino]acetate |
|---|---|
| PubChem CID | 20844331 |
| Molecular Formula | C4H9K2N3O5P+ |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | dipotassium;2-[methyl-[(Z)-N'-phosphonocarbamimidoyl]amino]acetate |
| SMILES | CN(CC(=O)[O-])/C(N)=N\P(=O)(O)O.[K+].[K+] |
| InChI | InChI=1S/C4H10N3O5P.2K/c1-7(2-3(8)9)4(5)6-13(10,11)12;;/h2H2,1H3,(H,8,9)(H4,5,6,10,11,12);;/q;2*+1/p-1 |
| InChIKey | SQOKPBMWFCQTDM-UHFFFAOYSA-M |
| XLogP | -8.92 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -8.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|